C14H17F2NO — CID 139364476
(4-fluorophenyl)-[(3R)-3-fluoro-4-propan-2-ylpyrrolidin-1-yl]methanone (PubChem CID 139364476) has the molecular formula C14H17F2NO and a molecular weight of 253.29 g/mol. Its IUPAC name is (4-fluorophenyl)-[(3R)-3-fluoro-4-propan-2-ylpyrrolidin-1-yl]methanone.
| Compound Name | (4-fluorophenyl)-[(3R)-3-fluoro-4-propan-2-ylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 139364476 |
| Molecular Formula | C14H17F2NO |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | (4-fluorophenyl)-[(3R)-3-fluoro-4-propan-2-ylpyrrolidin-1-yl]methanone |
| SMILES | CC(C)C1CN(C(=O)c2ccc(F)cc2)C[C@@H]1F |
| InChI | InChI=1S/C14H17F2NO/c1-9(2)12-7-17(8-13(12)16)14(18)10-3-5-11(15)6-4-10/h3-6,9,12-13H,7-8H2,1-2H3/t12?,13-/m0/s1 |
| InChIKey | OHERILQACKTLLN-ABLWVSNPSA-N |
| XLogP | 2.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |