C23H38O4 — CID 139365035
diethyl 4-[(E)-6,7,7-trimethyloct-5-en-2-yl]cyclohex-4-ene-1,2-dicarboxylate (PubChem CID 139365035) has the molecular formula C23H38O4 and a molecular weight of 378.55 g/mol. Its IUPAC name is diethyl 4-[(E)-6,7,7-trimethyloct-5-en-2-yl]cyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | diethyl 4-[(E)-6,7,7-trimethyloct-5-en-2-yl]cyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139365035 |
| Molecular Formula | C23H38O4 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | diethyl 4-[(E)-6,7,7-trimethyloct-5-en-2-yl]cyclohex-4-ene-1,2-dicarboxylate |
| SMILES | CCOC(=O)C1CC=C(C(C)CC/C=C(\C)C(C)(C)C)CC1C(=O)OCC |
| InChI | InChI=1S/C23H38O4/c1-8-26-21(24)19-14-13-18(15-20(19)22(25)27-9-2)16(3)11-10-12-17(4)23(5,6)7/h12-13,16,19-20H,8-11,14-15H2,1-7H3/b17-12+ |
| InChIKey | QQBXKWSNPDSYEI-SFQUDFHCSA-N |
| XLogP | 5.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|