C12H19N3 — CID 139365468
3-imino-4,5,6,7,8,9,10,11-octahydrocyclodeca[c]pyrrol-1-amine (PubChem CID 139365468) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is 3-imino-4,5,6,7,8,9,10,11-octahydrocyclodeca[c]pyrrol-1-amine.
| Compound Name | 3-imino-4,5,6,7,8,9,10,11-octahydrocyclodeca[c]pyrrol-1-amine |
|---|---|
| PubChem CID | 139365468 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 3-imino-4,5,6,7,8,9,10,11-octahydrocyclodeca[c]pyrrol-1-amine |
| SMILES | [H]/N=C1\N=C(N)C2=C1CCCCCCCC2 |
| InChI | InChI=1S/C12H19N3/c13-11-9-7-5-3-1-2-4-6-8-10(9)12(14)15-11/h1-8H2,(H3,13,14,15) |
| InChIKey | KGPCSZFAWOLWGT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|