C27H31F3N6O — CID 139365763
4-[5-(2-cyclopropyl-3,4-dimethylanilino)-1-piperidin-4-yl-1,2,4-triazol-3-yl]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 139365763) has the molecular formula C27H31F3N6O and a molecular weight of 512.58 g/mol. Its IUPAC name is 4-[5-(2-cyclopropyl-3,4-dimethylanilino)-1-piperidin-4-yl-1,2,4-triazol-3-yl]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-[5-(2-cyclopropyl-3,4-dimethylanilino)-1-piperidin-4-yl-1,2,4-triazol-3-yl]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 139365763 |
| Molecular Formula | C27H31F3N6O |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | 4-[5-(2-cyclopropyl-3,4-dimethylanilino)-1-piperidin-4-yl-1,2,4-triazol-3-yl]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | Cc1ccc(Nc2nc(-c3ccc(C(=O)NCC(F)(F)F)cc3)nn2C2CCNCC2)c(C2CC2)c1C |
| InChI | InChI=1S/C27H31F3N6O/c1-16-3-10-22(23(17(16)2)18-4-5-18)33-26-34-24(35-36(26)21-11-13-31-14-12-21)19-6-8-20(9-7-19)25(37)32-15-27(28,29)30/h3,6-10,18,21,31H,4-5,11-15H2,1-2H3,(H,32,37)(H,33,34,35) |
| InChIKey | BLJVNGBPSHDTFM-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |