C21H23ClF3N7O — CID 139365901
4-chloro-N-[2-methyl-5-[4-[2-(1,1,1-trifluoropropan-2-ylamino)ethoxy]cyclohexa-1,3-dien-1-yl]-1,2,4-triazol-3-yl]-1H-indazol-5-amine (PubChem CID 139365901) has the molecular formula C21H23ClF3N7O and a molecular weight of 481.91 g/mol. Its IUPAC name is 4-chloro-N-[2-methyl-5-[4-[2-(1,1,1-trifluoropropan-2-ylamino)ethoxy]cyclohexa-1,3-dien-1-yl]-1,2,4-triazol-3-yl]-1H-indazol-5-amine.
| Compound Name | 4-chloro-N-[2-methyl-5-[4-[2-(1,1,1-trifluoropropan-2-ylamino)ethoxy]cyclohexa-1,3-dien-1-yl]-1,2,4-triazol-3-yl]-1H-indazol-5-amine |
|---|---|
| PubChem CID | 139365901 |
| Molecular Formula | C21H23ClF3N7O |
| Molecular Weight | 481.91 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 4-chloro-N-[2-methyl-5-[4-[2-(1,1,1-trifluoropropan-2-ylamino)ethoxy]cyclohexa-1,3-dien-1-yl]-1,2,4-triazol-3-yl]-1H-indazol-5-amine |
| SMILES | CC(NCCOC1=CC=C(c2nc(Nc3ccc4[nH]ncc4c3Cl)n(C)n2)CC1)C(F)(F)F |
| InChI | InChI=1S/C21H23ClF3N7O/c1-12(21(23,24)25)26-9-10-33-14-5-3-13(4-6-14)19-29-20(32(2)31-19)28-17-8-7-16-15(18(17)22)11-27-30-16/h3,5,7-8,11-12,26H,4,6,9-10H2,1-2H3,(H,27,30)(H,28,29,31) |
| InChIKey | OMUBEUQJPAYWEY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.91 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|