C20H19FN4O4 — CID 139366506
N-(4-cyanooxan-4-yl)-4-[[2-(5-fluoro-2-hydroxyphenyl)acetyl]amino]pyridine-2-carboxamide (PubChem CID 139366506) has the molecular formula C20H19FN4O4 and a molecular weight of 398.39 g/mol. Its IUPAC name is N-(4-cyanooxan-4-yl)-4-[[2-(5-fluoro-2-hydroxyphenyl)acetyl]amino]pyridine-2-carboxamide.
| Compound Name | N-(4-cyanooxan-4-yl)-4-[[2-(5-fluoro-2-hydroxyphenyl)acetyl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 139366506 |
| Molecular Formula | C20H19FN4O4 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-(4-cyanooxan-4-yl)-4-[[2-(5-fluoro-2-hydroxyphenyl)acetyl]amino]pyridine-2-carboxamide |
| SMILES | N#CC1(NC(=O)c2cc(NC(=O)Cc3cc(F)ccc3O)ccn2)CCOCC1 |
| InChI | InChI=1S/C20H19FN4O4/c21-14-1-2-17(26)13(9-14)10-18(27)24-15-3-6-23-16(11-15)19(28)25-20(12-22)4-7-29-8-5-20/h1-3,6,9,11,26H,4-5,7-8,10H2,(H,25,28)(H,23,24,27) |
| InChIKey | QMAGELZSZBHISS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 124.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |