C24H17ClFN5O3 — CID 139366936
1-N-[4-(7-chloropyrido[3,2-d]pyrimidin-4-yl)oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 139366936) has the molecular formula C24H17ClFN5O3 and a molecular weight of 477.88 g/mol. Its IUPAC name is 1-N-[4-(7-chloropyrido[3,2-d]pyrimidin-4-yl)oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-[4-(7-chloropyrido[3,2-d]pyrimidin-4-yl)oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 139366936 |
| Molecular Formula | C24H17ClFN5O3 |
| Molecular Weight | 477.88 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | 1-N-[4-(7-chloropyrido[3,2-d]pyrimidin-4-yl)oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)C1(C(=O)Nc2ccc(Oc3ncnc4cc(Cl)cnc34)cc2)CC1 |
| InChI | InChI=1S/C24H17ClFN5O3/c25-14-11-19-20(27-12-14)21(29-13-28-19)34-18-7-5-17(6-8-18)31-23(33)24(9-10-24)22(32)30-16-3-1-15(26)2-4-16/h1-8,11-13H,9-10H2,(H,30,32)(H,31,33) |
| InChIKey | TXZRIDXMQZUDMK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.88 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|