C14H28N2O8 — CID 139366979
2,3-dihydroxybutanedioate;bis(4,4-dimethyl-1,3-oxazolidin-3-ium) (PubChem CID 139366979) has the molecular formula C14H28N2O8 and a molecular weight of 352.38 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioate;bis(4,4-dimethyl-1,3-oxazolidin-3-ium).
| Compound Name | 2,3-dihydroxybutanedioate;bis(4,4-dimethyl-1,3-oxazolidin-3-ium) |
|---|---|
| PubChem CID | 139366979 |
| Molecular Formula | C14H28N2O8 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 2,3-dihydroxybutanedioate;bis(4,4-dimethyl-1,3-oxazolidin-3-ium) |
| SMILES | CC1(C)COC[NH2+]1.CC1(C)COC[NH2+]1.O=C([O-])C(O)C(O)C(=O)[O-] |
| InChI | InChI=1S/2C5H11NO.C4H6O6/c2*1-5(2)3-7-4-6-5;5-1(3(7)8)2(6)4(9)10/h2*6H,3-4H2,1-2H3;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | GGEMQIQNOIHENV-UHFFFAOYSA-N |
| XLogP | -6.16 |
| TPSA | 172.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | -6.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |