C14H9F5 — CID 139366997
1-(1,1,2,2,2-pentafluoroethyl)-2-phenylbenzene (PubChem CID 139366997) has the molecular formula C14H9F5 and a molecular weight of 272.22 g/mol. Its IUPAC name is 1-(1,1,2,2,2-pentafluoroethyl)-2-phenylbenzene.
| Compound Name | 1-(1,1,2,2,2-pentafluoroethyl)-2-phenylbenzene |
|---|---|
| PubChem CID | 139366997 |
| Molecular Formula | C14H9F5 |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 1-(1,1,2,2,2-pentafluoroethyl)-2-phenylbenzene |
| SMILES | FC(F)(F)C(F)(F)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C14H9F5/c15-13(16,14(17,18)19)12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H |
| InChIKey | SHLNHFXOPOTBQI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|