C36H28FN5 — CID 139367383
6-fluoro-N,N-dimethyl-4-(8-trityl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)pyridin-2-amine (PubChem CID 139367383) has the molecular formula C36H28FN5 and a molecular weight of 549.65 g/mol. Its IUPAC name is 6-fluoro-N,N-dimethyl-4-(8-trityl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)pyridin-2-amine.
| Compound Name | 6-fluoro-N,N-dimethyl-4-(8-trityl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 139367383 |
| Molecular Formula | C36H28FN5 |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | 6-fluoro-N,N-dimethyl-4-(8-trityl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)pyridin-2-amine |
| SMILES | CN(C)c1cc(-c2ccc3c4cnccc4n(C(c4ccccc4)(c4ccccc4)c4ccccc4)c3n2)cc(F)n1 |
| InChI | InChI=1S/C36H28FN5/c1-41(2)34-23-25(22-33(37)40-34)31-19-18-29-30-24-38-21-20-32(30)42(35(29)39-31)36(26-12-6-3-7-13-26,27-14-8-4-9-15-27)28-16-10-5-11-17-28/h3-24H,1-2H3 |
| InChIKey | LFAPWKYZBDUUPH-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|