About 2-fluoro-3-[(1S,5R)-9-methoxy-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl]benzamide
2-fluoro-3-[(1S,5R)-9-methoxy-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl]benzamide (PubChem CID 139368022) has the molecular formula C17H23FN2O2
and a molecular weight of 306.38 g/mol. Its IUPAC name is 2-fluoro-3-[(1S,5R)-9-methoxy-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl]benzamide.
Molecular Properties
| Compound Name | 2-fluoro-3-[(1S,5R)-9-methoxy-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl]benzamide |
| PubChem CID | 139368022 |
| Molecular Formula | C17H23FN2O2 |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 2-fluoro-3-[(1S,5R)-9-methoxy-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl]benzamide |
| SMILES | COC1(c2cccc(C(N)=O)c2F)[C@@H]2CCC[C@H]1CN(C)C2 |
| InChI | InChI=1S/C17H23FN2O2/c1-20-9-11-5-3-6-12(10-20)17(11,22-2)14-8-4-7-13(15(14)18)16(19)21/h4,7-8,11-12H,3,5-6,9-10H2,1-2H3,(H2,19,21)/t11-,12+,17? |
| InChIKey | HRGFRFALZOMBIJ-GTKHYJCHSA-N |
| XLogP | 2.13 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-fluoro-3-[(1S,5R)-9-methoxy-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-3-[(1S,5R)-9-methoxy-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl]benzamide?
The IUPAC name of 2-fluoro-3-[(1S,5R)-9-methoxy-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl]benzamide (CID 139368022) is 2-fluoro-3-[(1S,5R)-9-methoxy-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl]benzamide.
What is the SMILES notation for 2-fluoro-3-[(1S,5R)-9-methoxy-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl]benzamide?
The canonical SMILES for 2-fluoro-3-[(1S,5R)-9-methoxy-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl]benzamide is COC1(c2cccc(C(N)=O)c2F)[C@@H]2CCC[C@H]1CN(C)C2.
What is the InChIKey of 2-fluoro-3-[(1S,5R)-9-methoxy-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl]benzamide?
The InChIKey is HRGFRFALZOMBIJ-GTKHYJCHSA-N. The full InChI is InChI=1S/C17H23FN2O2/c1-20-9-11-5-3-6-12(10-20)17(11,22-2)14-8-4-7-13(15(14)18)16(19)21/h4,7-8,11-12H,3,5-6,9-10H2,1-2H3,(H2,19,21)/t11-,12+,17?.
What are the key properties of 2-fluoro-3-[(1S,5R)-9-methoxy-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl]benzamide?
2-fluoro-3-[(1S,5R)-9-methoxy-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl]benzamide has a molecular weight of 306.38 g/mol, XLogP of 2.13, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3-[(1S,5R)-9-methoxy-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl]benzamide is sourced from PubChem (CID 139368022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).