C21H22N6O3 — CID 139368143
1-benzyl-N-[(7S)-1,5-dimethyl-2,6-dioxo-8,9-dihydro-7H-pyrido[3,2-b]azepin-7-yl]-1,2,4-triazole-3-carboxamide (PubChem CID 139368143) has the molecular formula C21H22N6O3 and a molecular weight of 406.45 g/mol. Its IUPAC name is 1-benzyl-N-[(7S)-1,5-dimethyl-2,6-dioxo-8,9-dihydro-7H-pyrido[3,2-b]azepin-7-yl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-benzyl-N-[(7S)-1,5-dimethyl-2,6-dioxo-8,9-dihydro-7H-pyrido[3,2-b]azepin-7-yl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 139368143 |
| Molecular Formula | C21H22N6O3 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 1-benzyl-N-[(7S)-1,5-dimethyl-2,6-dioxo-8,9-dihydro-7H-pyrido[3,2-b]azepin-7-yl]-1,2,4-triazole-3-carboxamide |
| SMILES | CN1C(=O)[C@@H](NC(=O)c2ncn(Cc3ccccc3)n2)CCc2c1ccc(=O)n2C |
| InChI | InChI=1S/C21H22N6O3/c1-25-16-9-8-15(21(30)26(2)17(16)10-11-18(25)28)23-20(29)19-22-13-27(24-19)12-14-6-4-3-5-7-14/h3-7,10-11,13,15H,8-9,12H2,1-2H3,(H,23,29)/t15-/m0/s1 |
| InChIKey | IIHOSZGWHGQGIR-HNNXBMFYSA-N |
| XLogP | 0.73 |
| TPSA | 102.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |