C20H19FN6O3 — CID 139368149
1-[(2-fluorophenyl)methyl]-N-[(3S)-1-methyl-2,7-dioxo-4,5-dihydro-3H-pyrido[1,2-a][1,3]diazepin-3-yl]-1,2,4-triazole-3-carboxamide (PubChem CID 139368149) has the molecular formula C20H19FN6O3 and a molecular weight of 410.41 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-N-[(3S)-1-methyl-2,7-dioxo-4,5-dihydro-3H-pyrido[1,2-a][1,3]diazepin-3-yl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-[(2-fluorophenyl)methyl]-N-[(3S)-1-methyl-2,7-dioxo-4,5-dihydro-3H-pyrido[1,2-a][1,3]diazepin-3-yl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 139368149 |
| Molecular Formula | C20H19FN6O3 |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-N-[(3S)-1-methyl-2,7-dioxo-4,5-dihydro-3H-pyrido[1,2-a][1,3]diazepin-3-yl]-1,2,4-triazole-3-carboxamide |
| SMILES | CN1C(=O)[C@@H](NC(=O)c2ncn(Cc3ccccc3F)n2)CCn2c1cccc2=O |
| InChI | InChI=1S/C20H19FN6O3/c1-25-16-7-4-8-17(28)27(16)10-9-15(20(25)30)23-19(29)18-22-12-26(24-18)11-13-5-2-3-6-14(13)21/h2-8,12,15H,9-11H2,1H3,(H,23,29)/t15-/m0/s1 |
| InChIKey | HQXJOJRPOWOODF-HNNXBMFYSA-N |
| XLogP | 0.79 |
| TPSA | 102.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |