C21H21FN6O3 — CID 139368171
N-[(7S)-1,5-dimethyl-2,6-dioxo-8,9-dihydro-7H-pyrido[3,2-b]azepin-7-yl]-1-[(2-fluorophenyl)methyl]-1,2,4-triazole-3-carboxamide (PubChem CID 139368171) has the molecular formula C21H21FN6O3 and a molecular weight of 424.44 g/mol. Its IUPAC name is N-[(7S)-1,5-dimethyl-2,6-dioxo-8,9-dihydro-7H-pyrido[3,2-b]azepin-7-yl]-1-[(2-fluorophenyl)methyl]-1,2,4-triazole-3-carboxamide.
| Compound Name | N-[(7S)-1,5-dimethyl-2,6-dioxo-8,9-dihydro-7H-pyrido[3,2-b]azepin-7-yl]-1-[(2-fluorophenyl)methyl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 139368171 |
| Molecular Formula | C21H21FN6O3 |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | N-[(7S)-1,5-dimethyl-2,6-dioxo-8,9-dihydro-7H-pyrido[3,2-b]azepin-7-yl]-1-[(2-fluorophenyl)methyl]-1,2,4-triazole-3-carboxamide |
| SMILES | CN1C(=O)[C@@H](NC(=O)c2ncn(Cc3ccccc3F)n2)CCc2c1ccc(=O)n2C |
| InChI | InChI=1S/C21H21FN6O3/c1-26-16-8-7-15(21(31)27(2)17(16)9-10-18(26)29)24-20(30)19-23-12-28(25-19)11-13-5-3-4-6-14(13)22/h3-6,9-10,12,15H,7-8,11H2,1-2H3,(H,24,30)/t15-/m0/s1 |
| InChIKey | XFXHTMMLJSZLQU-HNNXBMFYSA-N |
| XLogP | 0.87 |
| TPSA | 102.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |