C26H16N4O5 — CID 139368816
3-[[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]methyl]benzoic acid (PubChem CID 139368816) has the molecular formula C26H16N4O5 and a molecular weight of 464.44 g/mol. Its IUPAC name is 3-[[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]methyl]benzoic acid.
| Compound Name | 3-[[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 139368816 |
| Molecular Formula | C26H16N4O5 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 3-[[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]methyl]benzoic acid |
| SMILES | N#Cc1ccc2cc3c(=O)[nH]c(=O)nc-3n(-c3ccc(OCc4cccc(C(=O)O)c4)cc3)c2c1 |
| InChI | InChI=1S/C26H16N4O5/c27-13-15-4-5-17-12-21-23(28-26(34)29-24(21)31)30(22(17)11-15)19-6-8-20(9-7-19)35-14-16-2-1-3-18(10-16)25(32)33/h1-12H,14H2,(H,32,33)(H,29,31,34) |
| InChIKey | SOJKTYONPCJRAD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|