C24H14N4O3 — CID 139368894
10-(4-hydroxyphenyl)-2,4-dioxo-3-phenylpyrimido[4,5-b]quinoline-8-carbonitrile (PubChem CID 139368894) has the molecular formula C24H14N4O3 and a molecular weight of 406.40 g/mol. Its IUPAC name is 10-(4-hydroxyphenyl)-2,4-dioxo-3-phenylpyrimido[4,5-b]quinoline-8-carbonitrile.
| Compound Name | 10-(4-hydroxyphenyl)-2,4-dioxo-3-phenylpyrimido[4,5-b]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 139368894 |
| Molecular Formula | C24H14N4O3 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 10-(4-hydroxyphenyl)-2,4-dioxo-3-phenylpyrimido[4,5-b]quinoline-8-carbonitrile |
| SMILES | N#Cc1ccc2cc3c(=O)n(-c4ccccc4)c(=O)nc-3n(-c3ccc(O)cc3)c2c1 |
| InChI | InChI=1S/C24H14N4O3/c25-14-15-6-7-16-13-20-22(27(21(16)12-15)18-8-10-19(29)11-9-18)26-24(31)28(23(20)30)17-4-2-1-3-5-17/h1-13,29H |
| InChIKey | XWCDULWMJXLKHR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|