About methyl 3-[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]benzoate
methyl 3-[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]benzoate (PubChem CID 139368907) has the molecular formula C26H16N4O5
and a molecular weight of 464.44 g/mol. Its IUPAC name is methyl 3-[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]benzoate.
Molecular Properties
| Compound Name | methyl 3-[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]benzoate |
| PubChem CID | 139368907 |
| Molecular Formula | C26H16N4O5 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | methyl 3-[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]benzoate |
| SMILES | COC(=O)c1cccc(Oc2ccc(-n3c4nc(=O)[nH]c(=O)c-4cc4ccc(C#N)cc43)cc2)c1 |
| InChI | InChI=1S/C26H16N4O5/c1-34-25(32)17-3-2-4-20(12-17)35-19-9-7-18(8-10-19)30-22-11-15(14-27)5-6-16(22)13-21-23(30)28-26(33)29-24(21)31/h2-13H,1H3,(H,29,31,33) |
| InChIKey | WLEHEPUMCIBZNN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]benzoate?
The IUPAC name of methyl 3-[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]benzoate (CID 139368907) is methyl 3-[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]benzoate.
What is the SMILES notation for methyl 3-[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]benzoate?
The canonical SMILES for methyl 3-[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]benzoate is COC(=O)c1cccc(Oc2ccc(-n3c4nc(=O)[nH]c(=O)c-4cc4ccc(C#N)cc43)cc2)c1.
What is the InChIKey of methyl 3-[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]benzoate?
The InChIKey is WLEHEPUMCIBZNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H16N4O5/c1-34-25(32)17-3-2-4-20(12-17)35-19-9-7-18(8-10-19)30-22-11-15(14-27)5-6-16(22)13-21-23(30)28-26(33)29-24(21)31/h2-13H,1H3,(H,29,31,33).
What are the key properties of methyl 3-[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]benzoate?
methyl 3-[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]benzoate has a molecular weight of 464.44 g/mol, XLogP of 3.63, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]benzoate is sourced from PubChem (CID 139368907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).