About 3-[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]benzoic acid
3-[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]benzoic acid (PubChem CID 139368954) has the molecular formula C25H14N4O5
and a molecular weight of 450.41 g/mol. Its IUPAC name is 3-[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]benzoic acid.
Molecular Properties
| Compound Name | 3-[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]benzoic acid |
| PubChem CID | 139368954 |
| Molecular Formula | C25H14N4O5 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 3-[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]benzoic acid |
| SMILES | N#Cc1ccc2cc3c(=O)[nH]c(=O)nc-3n(-c3ccc(Oc4cccc(C(=O)O)c4)cc3)c2c1 |
| InChI | InChI=1S/C25H14N4O5/c26-13-14-4-5-15-12-20-22(27-25(33)28-23(20)30)29(21(15)10-14)17-6-8-18(9-7-17)34-19-3-1-2-16(11-19)24(31)32/h1-12H,(H,31,32)(H,28,30,33) |
| InChIKey | OPLLHUGSJPSERF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]benzoic acid?
The IUPAC name of 3-[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]benzoic acid (CID 139368954) is 3-[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]benzoic acid.
What is the SMILES notation for 3-[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]benzoic acid?
The canonical SMILES for 3-[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]benzoic acid is N#Cc1ccc2cc3c(=O)[nH]c(=O)nc-3n(-c3ccc(Oc4cccc(C(=O)O)c4)cc3)c2c1.
What is the InChIKey of 3-[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]benzoic acid?
The InChIKey is OPLLHUGSJPSERF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H14N4O5/c26-13-14-4-5-15-12-20-22(27-25(33)28-23(20)30)29(21(15)10-14)17-6-8-18(9-7-17)34-19-3-1-2-16(11-19)24(31)32/h1-12H,(H,31,32)(H,28,30,33).
What are the key properties of 3-[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]benzoic acid?
3-[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]benzoic acid has a molecular weight of 450.41 g/mol, XLogP of 3.54, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]benzoic acid is sourced from PubChem (CID 139368954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).