C19H10N4O4 — CID 139368966
10-(1,3-benzodioxol-5-yl)-2,4-dioxopyrimido[4,5-b]quinoline-8-carbonitrile (PubChem CID 139368966) has the molecular formula C19H10N4O4 and a molecular weight of 358.31 g/mol. Its IUPAC name is 10-(1,3-benzodioxol-5-yl)-2,4-dioxopyrimido[4,5-b]quinoline-8-carbonitrile.
| Compound Name | 10-(1,3-benzodioxol-5-yl)-2,4-dioxopyrimido[4,5-b]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 139368966 |
| Molecular Formula | C19H10N4O4 |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 10-(1,3-benzodioxol-5-yl)-2,4-dioxopyrimido[4,5-b]quinoline-8-carbonitrile |
| SMILES | N#Cc1ccc2cc3c(=O)[nH]c(=O)nc-3n(-c3ccc4c(c3)OCO4)c2c1 |
| InChI | InChI=1S/C19H10N4O4/c20-8-10-1-2-11-6-13-17(21-19(25)22-18(13)24)23(14(11)5-10)12-3-4-15-16(7-12)27-9-26-15/h1-7H,9H2,(H,22,24,25) |
| InChIKey | JQRBGIPGRBJGEC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|