About 2-(5-methyl-1,3,4-oxadiazol-2-yl)butanoic acid
2-(5-methyl-1,3,4-oxadiazol-2-yl)butanoic acid (PubChem CID 139369462) has the molecular formula C7H10N2O3
and a molecular weight of 170.17 g/mol. Its IUPAC name is 2-(5-methyl-1,3,4-oxadiazol-2-yl)butanoic acid.
Molecular Properties
| Compound Name | 2-(5-methyl-1,3,4-oxadiazol-2-yl)butanoic acid |
| PubChem CID | 139369462 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 2-(5-methyl-1,3,4-oxadiazol-2-yl)butanoic acid |
| SMILES | CCC(C(=O)O)c1nnc(C)o1 |
| InChI | InChI=1S/C7H10N2O3/c1-3-5(7(10)11)6-9-8-4(2)12-6/h5H,3H2,1-2H3,(H,10,11) |
| InChIKey | OKBDDDCJBWQJMP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-methyl-1,3,4-oxadiazol-2-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methyl-1,3,4-oxadiazol-2-yl)butanoic acid?
The IUPAC name of 2-(5-methyl-1,3,4-oxadiazol-2-yl)butanoic acid (CID 139369462) is 2-(5-methyl-1,3,4-oxadiazol-2-yl)butanoic acid.
What is the SMILES notation for 2-(5-methyl-1,3,4-oxadiazol-2-yl)butanoic acid?
The canonical SMILES for 2-(5-methyl-1,3,4-oxadiazol-2-yl)butanoic acid is CCC(C(=O)O)c1nnc(C)o1.
What is the InChIKey of 2-(5-methyl-1,3,4-oxadiazol-2-yl)butanoic acid?
The InChIKey is OKBDDDCJBWQJMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c1-3-5(7(10)11)6-9-8-4(2)12-6/h5H,3H2,1-2H3,(H,10,11).
What are the key properties of 2-(5-methyl-1,3,4-oxadiazol-2-yl)butanoic acid?
2-(5-methyl-1,3,4-oxadiazol-2-yl)butanoic acid has a molecular weight of 170.17 g/mol, XLogP of 0.96, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methyl-1,3,4-oxadiazol-2-yl)butanoic acid is sourced from PubChem (CID 139369462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).