C24H20BrF2N5O4S — CID 139369541
[5-bromo-1-(oxan-2-yl)pyrazolo[5,4-b]pyridin-3-yl]-[2,6-difluoro-3-(phenylsulfamoylamino)phenyl]methanone (PubChem CID 139369541) has the molecular formula C24H20BrF2N5O4S and a molecular weight of 592.42 g/mol. Its IUPAC name is [5-bromo-1-(oxan-2-yl)pyrazolo[5,4-b]pyridin-3-yl]-[2,6-difluoro-3-(phenylsulfamoylamino)phenyl]methanone.
| Compound Name | [5-bromo-1-(oxan-2-yl)pyrazolo[5,4-b]pyridin-3-yl]-[2,6-difluoro-3-(phenylsulfamoylamino)phenyl]methanone |
|---|---|
| PubChem CID | 139369541 |
| Molecular Formula | C24H20BrF2N5O4S |
| Molecular Weight | 592.42 g/mol |
| Exact Mass | 591.04 |
| IUPAC Name | [5-bromo-1-(oxan-2-yl)pyrazolo[5,4-b]pyridin-3-yl]-[2,6-difluoro-3-(phenylsulfamoylamino)phenyl]methanone |
| SMILES | O=C(c1c(F)ccc(NS(=O)(=O)Nc2ccccc2)c1F)c1nn(C2CCCCO2)c2ncc(Br)cc12 |
| InChI | InChI=1S/C24H20BrF2N5O4S/c25-14-12-16-22(29-32(24(16)28-13-14)19-8-4-5-11-36-19)23(33)20-17(26)9-10-18(21(20)27)31-37(34,35)30-15-6-2-1-3-7-15/h1-3,6-7,9-10,12-13,19,30-31H,4-5,8,11H2 |
| InChIKey | SNJWKZLAIJWZAD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.42 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_E(2)', 'substructure': 'N/A'} |
|---|