C25H18F2N6O5S2 — CID 139369669
4-[3-[2,6-difluoro-3-(phenylsulfamoylamino)benzoyl]-2H-pyrazolo[3,4-b]pyridin-5-yl]benzenesulfonamide (PubChem CID 139369669) has the molecular formula C25H18F2N6O5S2 and a molecular weight of 584.59 g/mol. Its IUPAC name is 4-[3-[2,6-difluoro-3-(phenylsulfamoylamino)benzoyl]-2H-pyrazolo[3,4-b]pyridin-5-yl]benzenesulfonamide.
| Compound Name | 4-[3-[2,6-difluoro-3-(phenylsulfamoylamino)benzoyl]-2H-pyrazolo[3,4-b]pyridin-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 139369669 |
| Molecular Formula | C25H18F2N6O5S2 |
| Molecular Weight | 584.59 g/mol |
| Exact Mass | 584.07 |
| IUPAC Name | 4-[3-[2,6-difluoro-3-(phenylsulfamoylamino)benzoyl]-2H-pyrazolo[3,4-b]pyridin-5-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2cnc3n[nH]c(C(=O)c4c(F)ccc(NS(=O)(=O)Nc5ccccc5)c4F)c3c2)cc1 |
| InChI | InChI=1S/C25H18F2N6O5S2/c26-19-10-11-20(33-40(37,38)32-16-4-2-1-3-5-16)22(27)21(19)24(34)23-18-12-15(13-29-25(18)31-30-23)14-6-8-17(9-7-14)39(28,35)36/h1-13,32-33H,(H2,28,35,36)(H,29,30,31) |
| InChIKey | KSKZNZFLMZNVOK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 177.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.59 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_E(2)', 'substructure': 'N/A'} |
|---|