C13H9Cl2F3N2O — CID 139369764
5-(2,3-dichlorophenyl)-4-(2,2,2-trifluoroethoxy)pyridin-2-amine (PubChem CID 139369764) has the molecular formula C13H9Cl2F3N2O and a molecular weight of 337.13 g/mol. Its IUPAC name is 5-(2,3-dichlorophenyl)-4-(2,2,2-trifluoroethoxy)pyridin-2-amine.
| Compound Name | 5-(2,3-dichlorophenyl)-4-(2,2,2-trifluoroethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 139369764 |
| Molecular Formula | C13H9Cl2F3N2O |
| Molecular Weight | 337.13 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | 5-(2,3-dichlorophenyl)-4-(2,2,2-trifluoroethoxy)pyridin-2-amine |
| SMILES | Nc1cc(OCC(F)(F)F)c(-c2cccc(Cl)c2Cl)cn1 |
| InChI | InChI=1S/C13H9Cl2F3N2O/c14-9-3-1-2-7(12(9)15)8-5-20-11(19)4-10(8)21-6-13(16,17)18/h1-5H,6H2,(H2,19,20) |
| InChIKey | VAUKXPHLCWEPBD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.13 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |