About 5-chloro-2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine
5-chloro-2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine (PubChem CID 139370006) has the molecular formula C9H10ClN
and a molecular weight of 167.64 g/mol. Its IUPAC name is 5-chloro-2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine.
Molecular Properties
| Compound Name | 5-chloro-2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine |
| PubChem CID | 139370006 |
| Molecular Formula | C9H10ClN |
| Molecular Weight | 167.64 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 5-chloro-2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine |
| SMILES | Cc1ccc2c(n1)CCC2Cl |
| InChI | InChI=1S/C9H10ClN/c1-6-2-3-7-8(10)4-5-9(7)11-6/h2-3,8H,4-5H2,1H3 |
| InChIKey | RCIBLLVCAXMMRF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.64 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine?
The IUPAC name of 5-chloro-2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine (CID 139370006) is 5-chloro-2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine.
What is the SMILES notation for 5-chloro-2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine?
The canonical SMILES for 5-chloro-2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine is Cc1ccc2c(n1)CCC2Cl.
What is the InChIKey of 5-chloro-2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine?
The InChIKey is RCIBLLVCAXMMRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClN/c1-6-2-3-7-8(10)4-5-9(7)11-6/h2-3,8H,4-5H2,1H3.
What are the key properties of 5-chloro-2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine?
5-chloro-2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine has a molecular weight of 167.64 g/mol, XLogP of 2.62, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine is sourced from PubChem (CID 139370006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).