C13H7F8N3O4S — CID 139370269
N-methyl-N-(1,1,2,2,2-pentafluoroethylsulfonyl)-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide (PubChem CID 139370269) has the molecular formula C13H7F8N3O4S and a molecular weight of 453.27 g/mol. Its IUPAC name is N-methyl-N-(1,1,2,2,2-pentafluoroethylsulfonyl)-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide.
| Compound Name | N-methyl-N-(1,1,2,2,2-pentafluoroethylsulfonyl)-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
|---|---|
| PubChem CID | 139370269 |
| Molecular Formula | C13H7F8N3O4S |
| Molecular Weight | 453.27 g/mol |
| Exact Mass | 453.00 |
| IUPAC Name | N-methyl-N-(1,1,2,2,2-pentafluoroethylsulfonyl)-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
| SMILES | CN(C(=O)c1ccc(-c2noc(C(F)(F)F)n2)cc1)S(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H7F8N3O4S/c1-24(29(26,27)13(20,21)12(17,18)19)9(25)7-4-2-6(3-5-7)8-22-10(28-23-8)11(14,15)16/h2-5H,1H3 |
| InChIKey | WIHRTYVCRLMEOB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 93.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|