C12H6N6OS2 — CID 139370740
2-cyano-2-(5,6-dicyano-[1,3]dithiolo[4,5-b]pyrazin-2-ylidene)-N,N-dimethylacetamide (PubChem CID 139370740) has the molecular formula C12H6N6OS2 and a molecular weight of 314.36 g/mol. Its IUPAC name is 2-cyano-2-(5,6-dicyano-[1,3]dithiolo[4,5-b]pyrazin-2-ylidene)-N,N-dimethylacetamide.
| Compound Name | 2-cyano-2-(5,6-dicyano-[1,3]dithiolo[4,5-b]pyrazin-2-ylidene)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 139370740 |
| Molecular Formula | C12H6N6OS2 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 2-cyano-2-(5,6-dicyano-[1,3]dithiolo[4,5-b]pyrazin-2-ylidene)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C(C#N)=C1Sc2nc(C#N)c(C#N)nc2S1 |
| InChI | InChI=1S/C12H6N6OS2/c1-18(2)11(19)6(3-13)12-20-9-10(21-12)17-8(5-15)7(4-14)16-9/h1-2H3 |
| InChIKey | TVWMUACKHIUHAZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 117.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|