C15H4ClN5S2 — CID 139370780
2-[(2-chlorophenyl)-cyanomethylidene]-[1,3]dithiolo[4,5-b]pyrazine-5,6-dicarbonitrile (PubChem CID 139370780) has the molecular formula C15H4ClN5S2 and a molecular weight of 353.82 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)-cyanomethylidene]-[1,3]dithiolo[4,5-b]pyrazine-5,6-dicarbonitrile.
| Compound Name | 2-[(2-chlorophenyl)-cyanomethylidene]-[1,3]dithiolo[4,5-b]pyrazine-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 139370780 |
| Molecular Formula | C15H4ClN5S2 |
| Molecular Weight | 353.82 g/mol |
| Exact Mass | 352.96 |
| IUPAC Name | 2-[(2-chlorophenyl)-cyanomethylidene]-[1,3]dithiolo[4,5-b]pyrazine-5,6-dicarbonitrile |
| SMILES | N#CC(=C1Sc2nc(C#N)c(C#N)nc2S1)c1ccccc1Cl |
| InChI | InChI=1S/C15H4ClN5S2/c16-10-4-2-1-3-8(10)9(5-17)15-22-13-14(23-15)21-12(7-19)11(6-18)20-13/h1-4H |
| InChIKey | OYKUVBFASYNKIP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 97.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.82 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|