About (2S)-2-(2,5-diazaspiro[3.4]octan-2-yl)-3-hydroxypropanamide
(2S)-2-(2,5-diazaspiro[3.4]octan-2-yl)-3-hydroxypropanamide (PubChem CID 139370883) has the molecular formula C9H17N3O2
and a molecular weight of 199.25 g/mol. Its IUPAC name is (2S)-2-(2,5-diazaspiro[3.4]octan-2-yl)-3-hydroxypropanamide.
Molecular Properties
| Compound Name | (2S)-2-(2,5-diazaspiro[3.4]octan-2-yl)-3-hydroxypropanamide |
| PubChem CID | 139370883 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | (2S)-2-(2,5-diazaspiro[3.4]octan-2-yl)-3-hydroxypropanamide |
| SMILES | NC(=O)[C@H](CO)N1CC2(CCCN2)C1 |
| InChI | InChI=1S/C9H17N3O2/c10-8(14)7(4-13)12-5-9(6-12)2-1-3-11-9/h7,11,13H,1-6H2,(H2,10,14)/t7-/m0/s1 |
| InChIKey | AHXCLAQCUYFSSR-ZETCQYMHSA-N |
| XLogP | -1.73 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-(2,5-diazaspiro[3.4]octan-2-yl)-3-hydroxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(2,5-diazaspiro[3.4]octan-2-yl)-3-hydroxypropanamide?
The IUPAC name of (2S)-2-(2,5-diazaspiro[3.4]octan-2-yl)-3-hydroxypropanamide (CID 139370883) is (2S)-2-(2,5-diazaspiro[3.4]octan-2-yl)-3-hydroxypropanamide.
What is the SMILES notation for (2S)-2-(2,5-diazaspiro[3.4]octan-2-yl)-3-hydroxypropanamide?
The canonical SMILES for (2S)-2-(2,5-diazaspiro[3.4]octan-2-yl)-3-hydroxypropanamide is NC(=O)[C@H](CO)N1CC2(CCCN2)C1.
What is the InChIKey of (2S)-2-(2,5-diazaspiro[3.4]octan-2-yl)-3-hydroxypropanamide?
The InChIKey is AHXCLAQCUYFSSR-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H17N3O2/c10-8(14)7(4-13)12-5-9(6-12)2-1-3-11-9/h7,11,13H,1-6H2,(H2,10,14)/t7-/m0/s1.
What are the key properties of (2S)-2-(2,5-diazaspiro[3.4]octan-2-yl)-3-hydroxypropanamide?
(2S)-2-(2,5-diazaspiro[3.4]octan-2-yl)-3-hydroxypropanamide has a molecular weight of 199.25 g/mol, XLogP of -1.73, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(2,5-diazaspiro[3.4]octan-2-yl)-3-hydroxypropanamide is sourced from PubChem (CID 139370883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).