C36H45N5O4 — CID 139370884
N-(8-anilinooctyl)-1-[[2,6-dimethoxy-4-(2-methyl-1-oxo-2,7-naphthyridin-4-yl)phenyl]methyl]azetidine-3-carboxamide (PubChem CID 139370884) has the molecular formula C36H45N5O4 and a molecular weight of 611.79 g/mol. Its IUPAC name is N-(8-anilinooctyl)-1-[[2,6-dimethoxy-4-(2-methyl-1-oxo-2,7-naphthyridin-4-yl)phenyl]methyl]azetidine-3-carboxamide.
| Compound Name | N-(8-anilinooctyl)-1-[[2,6-dimethoxy-4-(2-methyl-1-oxo-2,7-naphthyridin-4-yl)phenyl]methyl]azetidine-3-carboxamide |
|---|---|
| PubChem CID | 139370884 |
| Molecular Formula | C36H45N5O4 |
| Molecular Weight | 611.79 g/mol |
| Exact Mass | 611.35 |
| IUPAC Name | N-(8-anilinooctyl)-1-[[2,6-dimethoxy-4-(2-methyl-1-oxo-2,7-naphthyridin-4-yl)phenyl]methyl]azetidine-3-carboxamide |
| SMILES | COc1cc(-c2cn(C)c(=O)c3cnccc23)cc(OC)c1CN1CC(C(=O)NCCCCCCCCNc2ccccc2)C1 |
| InChI | InChI=1S/C36H45N5O4/c1-40-24-31(29-15-18-37-21-30(29)36(40)43)26-19-33(44-2)32(34(20-26)45-3)25-41-22-27(23-41)35(42)39-17-12-7-5-4-6-11-16-38-28-13-9-8-10-14-28/h8-10,13-15,18-21,24,27,38H,4-7,11-12,16-17,22-23,25H2,1-3H3,(H,39,42) |
| InChIKey | MBZXJMIMFNPTOA-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.79 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|