About 2-cyclopropyl-4-[3,5-dimethoxy-4-(methylaminomethyl)phenyl]-2,7-naphthyridin-1-one
2-cyclopropyl-4-[3,5-dimethoxy-4-(methylaminomethyl)phenyl]-2,7-naphthyridin-1-one (PubChem CID 139370990) has the molecular formula C21H23N3O3
and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-cyclopropyl-4-[3,5-dimethoxy-4-(methylaminomethyl)phenyl]-2,7-naphthyridin-1-one.
Molecular Properties
| Compound Name | 2-cyclopropyl-4-[3,5-dimethoxy-4-(methylaminomethyl)phenyl]-2,7-naphthyridin-1-one |
| PubChem CID | 139370990 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 2-cyclopropyl-4-[3,5-dimethoxy-4-(methylaminomethyl)phenyl]-2,7-naphthyridin-1-one |
| SMILES | CNCc1c(OC)cc(-c2cn(C3CC3)c(=O)c3cnccc23)cc1OC |
| InChI | InChI=1S/C21H23N3O3/c1-22-10-17-19(26-2)8-13(9-20(17)27-3)18-12-24(14-4-5-14)21(25)16-11-23-7-6-15(16)18/h6-9,11-12,14,22H,4-5,10H2,1-3H3 |
| InChIKey | HVKXHGGPFUTNOB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-cyclopropyl-4-[3,5-dimethoxy-4-(methylaminomethyl)phenyl]-2,7-naphthyridin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-4-[3,5-dimethoxy-4-(methylaminomethyl)phenyl]-2,7-naphthyridin-1-one?
The IUPAC name of 2-cyclopropyl-4-[3,5-dimethoxy-4-(methylaminomethyl)phenyl]-2,7-naphthyridin-1-one (CID 139370990) is 2-cyclopropyl-4-[3,5-dimethoxy-4-(methylaminomethyl)phenyl]-2,7-naphthyridin-1-one.
What is the SMILES notation for 2-cyclopropyl-4-[3,5-dimethoxy-4-(methylaminomethyl)phenyl]-2,7-naphthyridin-1-one?
The canonical SMILES for 2-cyclopropyl-4-[3,5-dimethoxy-4-(methylaminomethyl)phenyl]-2,7-naphthyridin-1-one is CNCc1c(OC)cc(-c2cn(C3CC3)c(=O)c3cnccc23)cc1OC.
What is the InChIKey of 2-cyclopropyl-4-[3,5-dimethoxy-4-(methylaminomethyl)phenyl]-2,7-naphthyridin-1-one?
The InChIKey is HVKXHGGPFUTNOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O3/c1-22-10-17-19(26-2)8-13(9-20(17)27-3)18-12-24(14-4-5-14)21(25)16-11-23-7-6-15(16)18/h6-9,11-12,14,22H,4-5,10H2,1-3H3.
What are the key properties of 2-cyclopropyl-4-[3,5-dimethoxy-4-(methylaminomethyl)phenyl]-2,7-naphthyridin-1-one?
2-cyclopropyl-4-[3,5-dimethoxy-4-(methylaminomethyl)phenyl]-2,7-naphthyridin-1-one has a molecular weight of 365.43 g/mol, XLogP of 3.13, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-4-[3,5-dimethoxy-4-(methylaminomethyl)phenyl]-2,7-naphthyridin-1-one is sourced from PubChem (CID 139370990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).