C27H24F4N2O3S2 — CID 139371014
[2-[[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]amino]-2-oxoethyl] morpholine-4-carbodithioate (PubChem CID 139371014) has the molecular formula C27H24F4N2O3S2 and a molecular weight of 564.63 g/mol. Its IUPAC name is [2-[[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]amino]-2-oxoethyl] morpholine-4-carbodithioate.
| Compound Name | [2-[[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]amino]-2-oxoethyl] morpholine-4-carbodithioate |
|---|---|
| PubChem CID | 139371014 |
| Molecular Formula | C27H24F4N2O3S2 |
| Molecular Weight | 564.63 g/mol |
| Exact Mass | 564.12 |
| IUPAC Name | [2-[[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]amino]-2-oxoethyl] morpholine-4-carbodithioate |
| SMILES | O=C(CSC(=S)N1CCOCC1)NC1C/C(=C\c2ccc(F)c(F)c2)C(=O)/C(=C/c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C27H24F4N2O3S2/c28-21-3-1-16(11-23(21)30)9-18-13-20(32-25(34)15-38-27(37)33-5-7-36-8-6-33)14-19(26(18)35)10-17-2-4-22(29)24(31)12-17/h1-4,9-12,20H,5-8,13-15H2,(H,32,34)/b18-9+,19-10+ |
| InChIKey | HBYCROKUZPIIQQ-VNIJRHKQSA-N |
| XLogP | 4.91 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.63 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|