C39H43N7O8 — CID 139371164
2-[[2,6-dimethoxy-4-(2-methyl-1-oxo-2,7-naphthyridin-4-yl)phenyl]methyl-methylamino]-N-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentyl]acetamide (PubChem CID 139371164) has the molecular formula C39H43N7O8 and a molecular weight of 737.81 g/mol. Its IUPAC name is 2-[[2,6-dimethoxy-4-(2-methyl-1-oxo-2,7-naphthyridin-4-yl)phenyl]methyl-methylamino]-N-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentyl]acetamide.
| Compound Name | 2-[[2,6-dimethoxy-4-(2-methyl-1-oxo-2,7-naphthyridin-4-yl)phenyl]methyl-methylamino]-N-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentyl]acetamide |
|---|---|
| PubChem CID | 139371164 |
| Molecular Formula | C39H43N7O8 |
| Molecular Weight | 737.81 g/mol |
| Exact Mass | 737.32 |
| IUPAC Name | 2-[[2,6-dimethoxy-4-(2-methyl-1-oxo-2,7-naphthyridin-4-yl)phenyl]methyl-methylamino]-N-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentyl]acetamide |
| SMILES | COc1cc(-c2cn(C)c(=O)c3cnccc23)cc(OC)c1CN(C)CC(=O)NCCCCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C39H43N7O8/c1-44(20-28-31(53-3)17-23(18-32(28)54-4)27-21-45(2)37(50)26-19-40-16-13-24(26)27)22-34(48)42-15-7-5-6-14-41-29-10-8-9-25-35(29)39(52)46(38(25)51)30-11-12-33(47)43-36(30)49/h8-10,13,16-19,21,30,41H,5-7,11-12,14-15,20,22H2,1-4H3,(H,42,48)(H,43,47,49) |
| InChIKey | DYSOJOUMMOEXQD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 181.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.81 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|