C36H35N5O9 — CID 139371172
N-[[2,6-dimethoxy-4-(2-methyl-1-oxo-2,7-naphthyridin-4-yl)phenyl]methyl]-4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-methylbutanamide (PubChem CID 139371172) has the molecular formula C36H35N5O9 and a molecular weight of 681.70 g/mol. Its IUPAC name is N-[[2,6-dimethoxy-4-(2-methyl-1-oxo-2,7-naphthyridin-4-yl)phenyl]methyl]-4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-methylbutanamide.
| Compound Name | N-[[2,6-dimethoxy-4-(2-methyl-1-oxo-2,7-naphthyridin-4-yl)phenyl]methyl]-4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-methylbutanamide |
|---|---|
| PubChem CID | 139371172 |
| Molecular Formula | C36H35N5O9 |
| Molecular Weight | 681.70 g/mol |
| Exact Mass | 681.24 |
| IUPAC Name | N-[[2,6-dimethoxy-4-(2-methyl-1-oxo-2,7-naphthyridin-4-yl)phenyl]methyl]-4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-methylbutanamide |
| SMILES | COc1cc(-c2cn(C)c(=O)c3cnccc23)cc(OC)c1CN(C)C(=O)CCCOc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C36H35N5O9/c1-39(19-25-28(48-3)15-20(16-29(25)49-4)24-18-40(2)34(45)23-17-37-13-12-21(23)24)31(43)9-6-14-50-27-8-5-7-22-32(27)36(47)41(35(22)46)26-10-11-30(42)38-33(26)44/h5,7-8,12-13,15-18,26H,6,9-11,14,19H2,1-4H3,(H,38,42,44) |
| InChIKey | DNBFPSRDEXYPHO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 166.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.70 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|