C40H44N6O9 — CID 139371192
2-[2,3-dimethoxy-5-(2-methyl-1-oxo-2,7-naphthyridin-4-yl)phenoxy]-N-[8-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]octyl]acetamide (PubChem CID 139371192) has the molecular formula C40H44N6O9 and a molecular weight of 752.83 g/mol. Its IUPAC name is 2-[2,3-dimethoxy-5-(2-methyl-1-oxo-2,7-naphthyridin-4-yl)phenoxy]-N-[8-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]octyl]acetamide.
| Compound Name | 2-[2,3-dimethoxy-5-(2-methyl-1-oxo-2,7-naphthyridin-4-yl)phenoxy]-N-[8-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]octyl]acetamide |
|---|---|
| PubChem CID | 139371192 |
| Molecular Formula | C40H44N6O9 |
| Molecular Weight | 752.83 g/mol |
| Exact Mass | 752.32 |
| IUPAC Name | 2-[2,3-dimethoxy-5-(2-methyl-1-oxo-2,7-naphthyridin-4-yl)phenoxy]-N-[8-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]octyl]acetamide |
| SMILES | COc1cc(-c2cn(C)c(=O)c3cnccc23)cc(OCC(=O)NCCCCCCCCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)c1OC |
| InChI | InChI=1S/C40H44N6O9/c1-45-22-28(25-15-18-41-21-27(25)38(45)50)24-19-31(53-2)36(54-3)32(20-24)55-23-34(48)43-17-9-7-5-4-6-8-16-42-29-12-10-11-26-35(29)40(52)46(39(26)51)30-13-14-33(47)44-37(30)49/h10-12,15,18-22,30,42H,4-9,13-14,16-17,23H2,1-3H3,(H,43,48)(H,44,47,49) |
| InChIKey | SIMJJMDLXYAUKN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 187.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.83 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|