C25H24F4N2O4S — CID 139371629
(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-1-(2-morpholin-4-ylethylsulfonyl)piperidin-4-one (PubChem CID 139371629) has the molecular formula C25H24F4N2O4S and a molecular weight of 524.54 g/mol. Its IUPAC name is (3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-1-(2-morpholin-4-ylethylsulfonyl)piperidin-4-one.
| Compound Name | (3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-1-(2-morpholin-4-ylethylsulfonyl)piperidin-4-one |
|---|---|
| PubChem CID | 139371629 |
| Molecular Formula | C25H24F4N2O4S |
| Molecular Weight | 524.54 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | (3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-1-(2-morpholin-4-ylethylsulfonyl)piperidin-4-one |
| SMILES | O=C1/C(=C/c2ccc(F)c(F)c2)CN(S(=O)(=O)CCN2CCOCC2)C/C1=C\c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C25H24F4N2O4S/c26-21-3-1-17(13-23(21)28)11-19-15-31(36(33,34)10-7-30-5-8-35-9-6-30)16-20(25(19)32)12-18-2-4-22(27)24(29)14-18/h1-4,11-14H,5-10,15-16H2/b19-11+,20-12+ |
| InChIKey | KIIUCIRJQJHNLD-AYKLPDECSA-N |
| XLogP | 3.26 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|