C37H37N5O9 — CID 139371673
N-[[2,6-dimethoxy-4-(2-methyl-1-oxo-2,7-naphthyridin-4-yl)phenyl]methyl]-5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-methylpentanamide (PubChem CID 139371673) has the molecular formula C37H37N5O9 and a molecular weight of 695.73 g/mol. Its IUPAC name is N-[[2,6-dimethoxy-4-(2-methyl-1-oxo-2,7-naphthyridin-4-yl)phenyl]methyl]-5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-methylpentanamide.
| Compound Name | N-[[2,6-dimethoxy-4-(2-methyl-1-oxo-2,7-naphthyridin-4-yl)phenyl]methyl]-5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-methylpentanamide |
|---|---|
| PubChem CID | 139371673 |
| Molecular Formula | C37H37N5O9 |
| Molecular Weight | 695.73 g/mol |
| Exact Mass | 695.26 |
| IUPAC Name | N-[[2,6-dimethoxy-4-(2-methyl-1-oxo-2,7-naphthyridin-4-yl)phenyl]methyl]-5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-methylpentanamide |
| SMILES | COc1cc(-c2cn(C)c(=O)c3cnccc23)cc(OC)c1CN(C)C(=O)CCCCOc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C37H37N5O9/c1-40(20-26-29(49-3)16-21(17-30(26)50-4)25-19-41(2)35(46)24-18-38-14-13-22(24)25)32(44)10-5-6-15-51-28-9-7-8-23-33(28)37(48)42(36(23)47)27-11-12-31(43)39-34(27)45/h7-9,13-14,16-19,27H,5-6,10-12,15,20H2,1-4H3,(H,39,43,45) |
| InChIKey | RCBOVHDPVJUXKK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 166.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.73 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|