C13H12BrF2N3O2 — CID 139371754
[(3S,4S)-3-amino-4-hydroxypyrrolidin-1-yl]-(5-bromo-6,7-difluoro-1H-indol-2-yl)methanone (PubChem CID 139371754) has the molecular formula C13H12BrF2N3O2 and a molecular weight of 360.16 g/mol. Its IUPAC name is [(3S,4S)-3-amino-4-hydroxypyrrolidin-1-yl]-(5-bromo-6,7-difluoro-1H-indol-2-yl)methanone.
| Compound Name | [(3S,4S)-3-amino-4-hydroxypyrrolidin-1-yl]-(5-bromo-6,7-difluoro-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 139371754 |
| Molecular Formula | C13H12BrF2N3O2 |
| Molecular Weight | 360.16 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | [(3S,4S)-3-amino-4-hydroxypyrrolidin-1-yl]-(5-bromo-6,7-difluoro-1H-indol-2-yl)methanone |
| SMILES | N[C@H]1CN(C(=O)c2cc3cc(Br)c(F)c(F)c3[nH]2)C[C@@H]1O |
| InChI | InChI=1S/C13H12BrF2N3O2/c14-6-1-5-2-8(18-12(5)11(16)10(6)15)13(21)19-3-7(17)9(20)4-19/h1-2,7,9,18,20H,3-4,17H2/t7-,9-/m0/s1 |
| InChIKey | FCPWLKKXNNJEIT-CBAPKCEASA-N |
| XLogP | 1.35 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.16 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|