C16H24N4O4 — CID 139372419
1-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]-3,5-dimethyl-1,3,5-triazinane-2,4,6-trione (PubChem CID 139372419) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is 1-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]-3,5-dimethyl-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]-3,5-dimethyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 139372419 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 1-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]-3,5-dimethyl-1,3,5-triazinane-2,4,6-trione |
| SMILES | Cn1c(=O)n(C)c(=O)n(CC2(C)CC(N=C=O)CC(C)(C)C2)c1=O |
| InChI | InChI=1S/C16H24N4O4/c1-15(2)6-11(17-10-21)7-16(3,8-15)9-20-13(23)18(4)12(22)19(5)14(20)24/h11H,6-9H2,1-5H3 |
| InChIKey | XZSNGOYESCCDIN-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 95.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|