C30H25N5O6 — CID 139372460
4-[6-(4-aminophenyl)-5-[(2E,4E)-5-carboxyhepta-2,4,6-trien-2-yl]-3-(5-methyl-2,4-dioxopyrimidin-1-yl)pyrazin-2-yl]benzoic acid (PubChem CID 139372460) has the molecular formula C30H25N5O6 and a molecular weight of 551.56 g/mol. Its IUPAC name is 4-[6-(4-aminophenyl)-5-[(2E,4E)-5-carboxyhepta-2,4,6-trien-2-yl]-3-(5-methyl-2,4-dioxopyrimidin-1-yl)pyrazin-2-yl]benzoic acid.
| Compound Name | 4-[6-(4-aminophenyl)-5-[(2E,4E)-5-carboxyhepta-2,4,6-trien-2-yl]-3-(5-methyl-2,4-dioxopyrimidin-1-yl)pyrazin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 139372460 |
| Molecular Formula | C30H25N5O6 |
| Molecular Weight | 551.56 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | 4-[6-(4-aminophenyl)-5-[(2E,4E)-5-carboxyhepta-2,4,6-trien-2-yl]-3-(5-methyl-2,4-dioxopyrimidin-1-yl)pyrazin-2-yl]benzoic acid |
| SMILES | C=C/C(=C\C=C(/C)c1nc(-n2cc(C)c(=O)[nH]c2=O)c(-c2ccc(C(=O)O)cc2)nc1-c1ccc(N)cc1)C(=O)O |
| InChI | InChI=1S/C30H25N5O6/c1-4-18(28(37)38)6-5-16(2)23-24(19-11-13-22(31)14-12-19)32-25(20-7-9-21(10-8-20)29(39)40)26(33-23)35-15-17(3)27(36)34-30(35)41/h4-15H,1,31H2,2-3H3,(H,37,38)(H,39,40)(H,34,36,41)/b16-5+,18-6+ |
| InChIKey | KCXYYODJPLSXNE-ZNYRDBRMSA-N |
| XLogP | 3.84 |
| TPSA | 181.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.56 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|