About [5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanimine
[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanimine (PubChem CID 139372794) has the molecular formula C8H8F3N
and a molecular weight of 175.15 g/mol. Its IUPAC name is [5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanimine.
Molecular Properties
| Compound Name | [5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanimine |
| PubChem CID | 139372794 |
| Molecular Formula | C8H8F3N |
| Molecular Weight | 175.15 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | [5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanimine |
| SMILES | [H]/N=C/C1C=CC=C(C(F)(F)F)C1 |
| InChI | InChI=1S/C8H8F3N/c9-8(10,11)7-3-1-2-6(4-7)5-12/h1-3,5-6,12H,4H2/b12-5+ |
| InChIKey | MUCWEIUDKPMTTO-LFYBBSHMSA-N |
| XLogP | 2.70 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.15 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanimine?
The IUPAC name of [5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanimine (CID 139372794) is [5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanimine.
What is the SMILES notation for [5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanimine?
The canonical SMILES for [5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanimine is [H]/N=C/C1C=CC=C(C(F)(F)F)C1.
What is the InChIKey of [5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanimine?
The InChIKey is MUCWEIUDKPMTTO-LFYBBSHMSA-N. The full InChI is InChI=1S/C8H8F3N/c9-8(10,11)7-3-1-2-6(4-7)5-12/h1-3,5-6,12H,4H2/b12-5+.
What are the key properties of [5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanimine?
[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanimine has a molecular weight of 175.15 g/mol, XLogP of 2.70, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanimine is sourced from PubChem (CID 139372794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).