C33H51N — CID 139373009
(Z)-N-methyl-4-[2-[(Z)-3-methylpent-2-en-2-yl]-3-(5,6,9-trimethyl-6-prop-1-enyldeca-3,9-dien-5-yl)cyclohexa-1,5-dien-1-yl]but-2-en-1-imine (PubChem CID 139373009) has the molecular formula C33H51N and a molecular weight of 461.78 g/mol. Its IUPAC name is (Z)-N-methyl-4-[2-[(Z)-3-methylpent-2-en-2-yl]-3-(5,6,9-trimethyl-6-prop-1-enyldeca-3,9-dien-5-yl)cyclohexa-1,5-dien-1-yl]but-2-en-1-imine.
| Compound Name | (Z)-N-methyl-4-[2-[(Z)-3-methylpent-2-en-2-yl]-3-(5,6,9-trimethyl-6-prop-1-enyldeca-3,9-dien-5-yl)cyclohexa-1,5-dien-1-yl]but-2-en-1-imine |
|---|---|
| PubChem CID | 139373009 |
| Molecular Formula | C33H51N |
| Molecular Weight | 461.78 g/mol |
| Exact Mass | 461.40 |
| IUPAC Name | (Z)-N-methyl-4-[2-[(Z)-3-methylpent-2-en-2-yl]-3-(5,6,9-trimethyl-6-prop-1-enyldeca-3,9-dien-5-yl)cyclohexa-1,5-dien-1-yl]but-2-en-1-imine |
| SMILES | C=C(C)CCC(C)(C=CC)C(C)(C=CCC)C1CC=CC(C/C=C\C=N\C)=C1/C(C)=C(/C)CC |
| InChI | InChI=1S/C33H51N/c1-11-14-23-33(9,32(8,22-12-2)24-21-26(4)5)30-20-17-19-29(18-15-16-25-34-10)31(30)28(7)27(6)13-3/h12,14-17,19,22-23,25,30H,4,11,13,18,20-21,24H2,1-3,5-10H3/b16-15-,22-12?,23-14?,28-27-,34-25+ |
| InChIKey | HXRCERIPNKAFRA-HBMVUJITSA-N |
| XLogP | 10.16 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.78 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|