C13H20N2O2 — CID 139373548
1-[(1R,2S)-2-hydroxycyclopentyl]-3-(propan-2-ylamino)pyridin-2-one (PubChem CID 139373548) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-[(1R,2S)-2-hydroxycyclopentyl]-3-(propan-2-ylamino)pyridin-2-one.
| Compound Name | 1-[(1R,2S)-2-hydroxycyclopentyl]-3-(propan-2-ylamino)pyridin-2-one |
|---|---|
| PubChem CID | 139373548 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 1-[(1R,2S)-2-hydroxycyclopentyl]-3-(propan-2-ylamino)pyridin-2-one |
| SMILES | CC(C)Nc1cccn([C@@H]2CCC[C@@H]2O)c1=O |
| InChI | InChI=1S/C13H20N2O2/c1-9(2)14-10-5-4-8-15(13(10)17)11-6-3-7-12(11)16/h4-5,8-9,11-12,14,16H,3,6-7H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | ORJPXGBPAHXEOL-NEPJUHHUSA-N |
| XLogP | 1.75 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |