C15H24FN3O — CID 139373553
1-[(3S)-1-(2-fluoroethyl)piperidin-3-yl]-3-(propan-2-ylamino)pyridin-2-one (PubChem CID 139373553) has the molecular formula C15H24FN3O and a molecular weight of 281.38 g/mol. Its IUPAC name is 1-[(3S)-1-(2-fluoroethyl)piperidin-3-yl]-3-(propan-2-ylamino)pyridin-2-one.
| Compound Name | 1-[(3S)-1-(2-fluoroethyl)piperidin-3-yl]-3-(propan-2-ylamino)pyridin-2-one |
|---|---|
| PubChem CID | 139373553 |
| Molecular Formula | C15H24FN3O |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 1-[(3S)-1-(2-fluoroethyl)piperidin-3-yl]-3-(propan-2-ylamino)pyridin-2-one |
| SMILES | CC(C)Nc1cccn([C@H]2CCCN(CCF)C2)c1=O |
| InChI | InChI=1S/C15H24FN3O/c1-12(2)17-14-6-4-9-19(15(14)20)13-5-3-8-18(11-13)10-7-16/h4,6,9,12-13,17H,3,5,7-8,10-11H2,1-2H3/t13-/m0/s1 |
| InChIKey | IUSSIGPSFMMRAN-ZDUSSCGKSA-N |
| XLogP | 2.28 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |