C12H19N3O — CID 139373654
N-[1-(dimethylamino)ethyl]-N,4-dimethylpyridine-3-carboxamide (PubChem CID 139373654) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is N-[1-(dimethylamino)ethyl]-N,4-dimethylpyridine-3-carboxamide.
| Compound Name | N-[1-(dimethylamino)ethyl]-N,4-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 139373654 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | N-[1-(dimethylamino)ethyl]-N,4-dimethylpyridine-3-carboxamide |
| SMILES | Cc1ccncc1C(=O)N(C)C(C)N(C)C |
| InChI | InChI=1S/C12H19N3O/c1-9-6-7-13-8-11(9)12(16)15(5)10(2)14(3)4/h6-8,10H,1-5H3 |
| InChIKey | XCWIUVAPXAKTHN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|