C22H28N4O — CID 139373785
2-[(1E,3E)-3-ethenyl-4-[methyl-(1-methylpiperidin-4-yl)amino]penta-1,3-dienyl]quinoxalin-6-ol (PubChem CID 139373785) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is 2-[(1E,3E)-3-ethenyl-4-[methyl-(1-methylpiperidin-4-yl)amino]penta-1,3-dienyl]quinoxalin-6-ol.
| Compound Name | 2-[(1E,3E)-3-ethenyl-4-[methyl-(1-methylpiperidin-4-yl)amino]penta-1,3-dienyl]quinoxalin-6-ol |
|---|---|
| PubChem CID | 139373785 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 2-[(1E,3E)-3-ethenyl-4-[methyl-(1-methylpiperidin-4-yl)amino]penta-1,3-dienyl]quinoxalin-6-ol |
| SMILES | C=CC(/C=C/c1cnc2cc(O)ccc2n1)=C(/C)N(C)C1CCN(C)CC1 |
| InChI | InChI=1S/C22H28N4O/c1-5-17(16(2)26(4)19-10-12-25(3)13-11-19)6-7-18-15-23-22-14-20(27)8-9-21(22)24-18/h5-9,14-15,19,27H,1,10-13H2,2-4H3/b7-6+,17-16+ |
| InChIKey | VIQXFVXYJMYBEB-QQIRETTESA-N |
| XLogP | 3.83 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|