C17H17FN6O2 — CID 139375298
6-fluoro-2-methyl-10-oxa-2,13,15,18,19,22-hexazatetracyclo[14.5.2.04,9.019,23]tricosa-1(22),4(9),5,7,16(23),17,20-heptaen-14-one (PubChem CID 139375298) has the molecular formula C17H17FN6O2 and a molecular weight of 356.36 g/mol. Its IUPAC name is 6-fluoro-2-methyl-10-oxa-2,13,15,18,19,22-hexazatetracyclo[14.5.2.04,9.019,23]tricosa-1(22),4(9),5,7,16(23),17,20-heptaen-14-one.
| Compound Name | 6-fluoro-2-methyl-10-oxa-2,13,15,18,19,22-hexazatetracyclo[14.5.2.04,9.019,23]tricosa-1(22),4(9),5,7,16(23),17,20-heptaen-14-one |
|---|---|
| PubChem CID | 139375298 |
| Molecular Formula | C17H17FN6O2 |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 6-fluoro-2-methyl-10-oxa-2,13,15,18,19,22-hexazatetracyclo[14.5.2.04,9.019,23]tricosa-1(22),4(9),5,7,16(23),17,20-heptaen-14-one |
| SMILES | CN1Cc2cc(F)ccc2OCCNC(=O)Nc2cnn3ccc1nc23 |
| InChI | InChI=1S/C17H17FN6O2/c1-23-10-11-8-12(18)2-3-14(11)26-7-5-19-17(25)21-13-9-20-24-6-4-15(23)22-16(13)24/h2-4,6,8-9H,5,7,10H2,1H3,(H2,19,21,25) |
| InChIKey | RRVWRGLZNFQLHC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 83.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |