C18H19F2N3O2 — CID 139375886
[4-[(3,5-difluorophenyl)methyl]piperazin-1-yl]-[4-(hydroxyamino)phenyl]methanone (PubChem CID 139375886) has the molecular formula C18H19F2N3O2 and a molecular weight of 347.37 g/mol. Its IUPAC name is [4-[(3,5-difluorophenyl)methyl]piperazin-1-yl]-[4-(hydroxyamino)phenyl]methanone.
| Compound Name | [4-[(3,5-difluorophenyl)methyl]piperazin-1-yl]-[4-(hydroxyamino)phenyl]methanone |
|---|---|
| PubChem CID | 139375886 |
| Molecular Formula | C18H19F2N3O2 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | [4-[(3,5-difluorophenyl)methyl]piperazin-1-yl]-[4-(hydroxyamino)phenyl]methanone |
| SMILES | O=C(c1ccc(NO)cc1)N1CCN(Cc2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C18H19F2N3O2/c19-15-9-13(10-16(20)11-15)12-22-5-7-23(8-6-22)18(24)14-1-3-17(21-25)4-2-14/h1-4,9-11,21,25H,5-8,12H2 |
| InChIKey | MNLOYHBOXAXJAO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|