About (Z)-N,2-bis(ethenyl)-N'-methylbut-2-enimidamide
(Z)-N,2-bis(ethenyl)-N'-methylbut-2-enimidamide (PubChem CID 139376181) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is (Z)-N,2-bis(ethenyl)-N'-methylbut-2-enimidamide.
Molecular Properties
| Compound Name | (Z)-N,2-bis(ethenyl)-N'-methylbut-2-enimidamide |
| PubChem CID | 139376181 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | (Z)-N,2-bis(ethenyl)-N'-methylbut-2-enimidamide |
| SMILES | C=CNC(=N\C)/C(C=C)=C\C |
| InChI | InChI=1S/C9H14N2/c1-5-8(6-2)9(10-4)11-7-3/h5-7H,1,3H2,2,4H3,(H,10,11)/b8-6- |
| InChIKey | ZNQTYXUYQBWMMR-VURMDHGXSA-N |
| XLogP | 1.88 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N,2-bis(ethenyl)-N'-methylbut-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N,2-bis(ethenyl)-N'-methylbut-2-enimidamide?
The IUPAC name of (Z)-N,2-bis(ethenyl)-N'-methylbut-2-enimidamide (CID 139376181) is (Z)-N,2-bis(ethenyl)-N'-methylbut-2-enimidamide.
What is the SMILES notation for (Z)-N,2-bis(ethenyl)-N'-methylbut-2-enimidamide?
The canonical SMILES for (Z)-N,2-bis(ethenyl)-N'-methylbut-2-enimidamide is C=CNC(=N\C)/C(C=C)=C\C.
What is the InChIKey of (Z)-N,2-bis(ethenyl)-N'-methylbut-2-enimidamide?
The InChIKey is ZNQTYXUYQBWMMR-VURMDHGXSA-N. The full InChI is InChI=1S/C9H14N2/c1-5-8(6-2)9(10-4)11-7-3/h5-7H,1,3H2,2,4H3,(H,10,11)/b8-6-.
What are the key properties of (Z)-N,2-bis(ethenyl)-N'-methylbut-2-enimidamide?
(Z)-N,2-bis(ethenyl)-N'-methylbut-2-enimidamide has a molecular weight of 150.22 g/mol, XLogP of 1.88, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N,2-bis(ethenyl)-N'-methylbut-2-enimidamide is sourced from PubChem (CID 139376181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).