C24H24N6O2 — CID 139376695
8-[4-[(E)-2-aminoethenyl]-2,6-dimethoxyphenyl]-2-N-(4-aminophenyl)quinazoline-2,4-diamine (PubChem CID 139376695) has the molecular formula C24H24N6O2 and a molecular weight of 428.50 g/mol. Its IUPAC name is 8-[4-[(E)-2-aminoethenyl]-2,6-dimethoxyphenyl]-2-N-(4-aminophenyl)quinazoline-2,4-diamine.
| Compound Name | 8-[4-[(E)-2-aminoethenyl]-2,6-dimethoxyphenyl]-2-N-(4-aminophenyl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 139376695 |
| Molecular Formula | C24H24N6O2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 8-[4-[(E)-2-aminoethenyl]-2,6-dimethoxyphenyl]-2-N-(4-aminophenyl)quinazoline-2,4-diamine |
| SMILES | COc1cc(/C=C/N)cc(OC)c1-c1cccc2c(N)nc(Nc3ccc(N)cc3)nc12 |
| InChI | InChI=1S/C24H24N6O2/c1-31-19-12-14(10-11-25)13-20(32-2)21(19)17-4-3-5-18-22(17)29-24(30-23(18)27)28-16-8-6-15(26)7-9-16/h3-13H,25-26H2,1-2H3,(H3,27,28,29,30)/b11-10+ |
| InChIKey | FXULMLBWRIZSKR-ZHACJKMWSA-N |
| XLogP | 4.15 |
| TPSA | 134.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|