About 8-[2,6-dimethyl-4-[(E)-pent-1-enyl]phenyl]-N-(4-methylphenyl)quinazolin-2-amine
8-[2,6-dimethyl-4-[(E)-pent-1-enyl]phenyl]-N-(4-methylphenyl)quinazolin-2-amine (PubChem CID 139376721) has the molecular formula C28H29N3
and a molecular weight of 407.56 g/mol. Its IUPAC name is 8-[2,6-dimethyl-4-[(E)-pent-1-enyl]phenyl]-N-(4-methylphenyl)quinazolin-2-amine.
Molecular Properties
| Compound Name | 8-[2,6-dimethyl-4-[(E)-pent-1-enyl]phenyl]-N-(4-methylphenyl)quinazolin-2-amine |
| PubChem CID | 139376721 |
| Molecular Formula | C28H29N3 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | 8-[2,6-dimethyl-4-[(E)-pent-1-enyl]phenyl]-N-(4-methylphenyl)quinazolin-2-amine |
| SMILES | CCC/C=C/c1cc(C)c(-c2cccc3cnc(Nc4ccc(C)cc4)nc23)c(C)c1 |
| InChI | InChI=1S/C28H29N3/c1-5-6-7-9-22-16-20(3)26(21(4)17-22)25-11-8-10-23-18-29-28(31-27(23)25)30-24-14-12-19(2)13-15-24/h7-18H,5-6H2,1-4H3,(H,29,30,31)/b9-7+ |
| InChIKey | FFOFDWSQSQAQCI-VQHVLOKHSA-N |
| XLogP | 7.78 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-[2,6-dimethyl-4-[(E)-pent-1-enyl]phenyl]-N-(4-methylphenyl)quinazolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[2,6-dimethyl-4-[(E)-pent-1-enyl]phenyl]-N-(4-methylphenyl)quinazolin-2-amine?
The IUPAC name of 8-[2,6-dimethyl-4-[(E)-pent-1-enyl]phenyl]-N-(4-methylphenyl)quinazolin-2-amine (CID 139376721) is 8-[2,6-dimethyl-4-[(E)-pent-1-enyl]phenyl]-N-(4-methylphenyl)quinazolin-2-amine.
What is the SMILES notation for 8-[2,6-dimethyl-4-[(E)-pent-1-enyl]phenyl]-N-(4-methylphenyl)quinazolin-2-amine?
The canonical SMILES for 8-[2,6-dimethyl-4-[(E)-pent-1-enyl]phenyl]-N-(4-methylphenyl)quinazolin-2-amine is CCC/C=C/c1cc(C)c(-c2cccc3cnc(Nc4ccc(C)cc4)nc23)c(C)c1.
What is the InChIKey of 8-[2,6-dimethyl-4-[(E)-pent-1-enyl]phenyl]-N-(4-methylphenyl)quinazolin-2-amine?
The InChIKey is FFOFDWSQSQAQCI-VQHVLOKHSA-N. The full InChI is InChI=1S/C28H29N3/c1-5-6-7-9-22-16-20(3)26(21(4)17-22)25-11-8-10-23-18-29-28(31-27(23)25)30-24-14-12-19(2)13-15-24/h7-18H,5-6H2,1-4H3,(H,29,30,31)/b9-7+.
What are the key properties of 8-[2,6-dimethyl-4-[(E)-pent-1-enyl]phenyl]-N-(4-methylphenyl)quinazolin-2-amine?
8-[2,6-dimethyl-4-[(E)-pent-1-enyl]phenyl]-N-(4-methylphenyl)quinazolin-2-amine has a molecular weight of 407.56 g/mol, XLogP of 7.78, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[2,6-dimethyl-4-[(E)-pent-1-enyl]phenyl]-N-(4-methylphenyl)quinazolin-2-amine is sourced from PubChem (CID 139376721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).